RaichuCS RaichuCS

23-04-2017
English

contestada

How successful are Lysander and hermia in getting to Lysander's aunt? Why don't they sleep close to each other

A Midsummer night's dream

Respuesta :

Аноним Аноним

23-04-2017

Lysander and Hermia do not get to the aunt. They do, however, try and make it into the forest. They do not sleep close to each other because Hermia thinks it undignified for an unmarried man and women to sleep close. Hope this helps!

Answer Link

Otras preguntas

Read the following excerpt from a research paper on American novels and answer the question. The argument continues about which novel has the honor of being the

Determine the points of intersection of the equation circumference x² + (y-3) ² = 25 with the coordinate axes.

Write a linear equation in point-slope form for the line that goes through (-1,1) and (1,-5). A. y+1 = -3(x+1) B. y-1 = 3(x+1) C. y+ 1 = 2(x - 1) D. y-1=-3(x +

What was the population density of the original sample? What would have happened if you had inoculated an agar plate with 1 mL of the original sample?

The leaves of both monocots and dicots contain different tissues in a different organization than in the stems and leaves, but again, share many similarities. V

What is the answer please help! make sure to explain. thanks!! Mrs. Anderton is giving a test in her third-period class. She has decided to record the amount of

Which graph shows a linear function? In the table

Please Answer The Mean! {NO EXPLANATION NEEDED!} <3

Let's consider the scenario: You bring a hunting rifle to forest, and you see a tree full of birds. You count 15 birds total. You shoot 1 down. HOw mAny are lef

Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3